C14H15BrCl2N6O — CID 91962126
3-N-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;dihydrochloride (PubChem CID 91962126) has the molecular formula C14H15BrCl2N6O and a molecular weight of 434.13 g/mol. Its IUPAC name is 3-N-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;dihydrochloride.
| Compound Name | 3-N-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 91962126 |
| Molecular Formula | C14H15BrCl2N6O |
| Molecular Weight | 434.13 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 3-N-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;dihydrochloride |
| SMILES | Cc1nnc(NN=Cc2ccc(-c3ccc(Br)cc3)o2)n1N.Cl.Cl |
| InChI | InChI=1S/C14H13BrN6O.2ClH/c1-9-18-20-14(21(9)16)19-17-8-12-6-7-13(22-12)10-2-4-11(15)5-3-10;;/h2-8H,16H2,1H3,(H,19,20);2*1H |
| InChIKey | RKXOJGXTDDPZBW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.13 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|