C14H13Cl2F3N6O2 — CID 91962204
3-N-[[5-[4-(trifluoromethoxy)phenyl]furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride (PubChem CID 91962204) has the molecular formula C14H13Cl2F3N6O2 and a molecular weight of 425.20 g/mol. Its IUPAC name is 3-N-[[5-[4-(trifluoromethoxy)phenyl]furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride.
| Compound Name | 3-N-[[5-[4-(trifluoromethoxy)phenyl]furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 91962204 |
| Molecular Formula | C14H13Cl2F3N6O2 |
| Molecular Weight | 425.20 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 3-N-[[5-[4-(trifluoromethoxy)phenyl]furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nn1cnnc1NN=Cc1ccc(-c2ccc(OC(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C14H11F3N6O2.2ClH/c15-14(16,17)25-10-3-1-9(2-4-10)12-6-5-11(24-12)7-19-21-13-22-20-8-23(13)18;;/h1-8H,18H2,(H,21,22);2*1H |
| InChIKey | BTEDLILIIPGACP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 103.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|