C28H16N8O6 — CID 98111643
5-[5-[(E)-[[4-[(E)-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylideneamino]-1,2,4-triazol-3-yl]hydrazinylidene]methyl]furan-2-yl]isoindole-1,3-dione (PubChem CID 98111643) has the molecular formula C28H16N8O6 and a molecular weight of 560.49 g/mol. Its IUPAC name is 5-[5-[(E)-[[4-[(E)-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylideneamino]-1,2,4-triazol-3-yl]hydrazinylidene]methyl]furan-2-yl]isoindole-1,3-dione.
| Compound Name | 5-[5-[(E)-[[4-[(E)-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylideneamino]-1,2,4-triazol-3-yl]hydrazinylidene]methyl]furan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 98111643 |
| Molecular Formula | C28H16N8O6 |
| Molecular Weight | 560.49 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | 5-[5-[(E)-[[4-[(E)-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylideneamino]-1,2,4-triazol-3-yl]hydrazinylidene]methyl]furan-2-yl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(-c3ccc(/C=N/Nc4nncn4/N=C/c4ccc(-c5ccc6c(c5)C(=O)NC6=O)o4)o3)ccc21 |
| InChI | InChI=1S/C28H16N8O6/c37-24-18-5-1-14(9-20(18)26(39)32-24)22-7-3-16(41-22)11-29-34-28-35-30-13-36(28)31-12-17-4-8-23(42-17)15-2-6-19-21(10-15)27(40)33-25(19)38/h1-13H,(H,34,35)(H,32,37,39)(H,33,38,40)/b29-11+,31-12+ |
| InChIKey | TXGNFFOFXVNDSH-JCPZJSQBSA-N |
| XLogP | 2.89 |
| TPSA | 186.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|