C16H10N6O4 — CID 27126918
N-[(E)-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 27126918) has the molecular formula C16H10N6O4 and a molecular weight of 350.29 g/mol. Its IUPAC name is N-[(E)-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[(E)-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 27126918 |
| Molecular Formula | C16H10N6O4 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | N-[(E)-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(-c2ccc3c(c2)C(=O)NC3=O)o1)c1ncn[nH]1 |
| InChI | InChI=1S/C16H10N6O4/c23-14-10-3-1-8(5-11(10)15(24)20-14)12-4-2-9(26-12)6-18-22-16(25)13-17-7-19-21-13/h1-7H,(H,22,25)(H,17,19,21)(H,20,23,24)/b18-6+ |
| InChIKey | YBBFIRYKLAESDO-NGYBGAFCSA-N |
| XLogP | 0.71 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|