C21H17N3O3 — CID 50884115
2-ethyl-5-[5-[(phenylhydrazinylidene)methyl]furan-2-yl]isoindole-1,3-dione (PubChem CID 50884115) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-ethyl-5-[5-[(phenylhydrazinylidene)methyl]furan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-ethyl-5-[5-[(phenylhydrazinylidene)methyl]furan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 50884115 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-ethyl-5-[5-[(phenylhydrazinylidene)methyl]furan-2-yl]isoindole-1,3-dione |
| SMILES | CCN1C(=O)c2ccc(-c3ccc(C=NNc4ccccc4)o3)cc2C1=O |
| InChI | InChI=1S/C21H17N3O3/c1-2-24-20(25)17-10-8-14(12-18(17)21(24)26)19-11-9-16(27-19)13-22-23-15-6-4-3-5-7-15/h3-13,23H,2H2,1H3 |
| InChIKey | VOUNFPHKOGPQNT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|