C16H8N2O4S2 — CID 1270528
5-[5-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]isoindole-1,3-dione (PubChem CID 1270528) has the molecular formula C16H8N2O4S2 and a molecular weight of 356.38 g/mol. Its IUPAC name is 5-[5-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]isoindole-1,3-dione.
| Compound Name | 5-[5-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1270528 |
| Molecular Formula | C16H8N2O4S2 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 5-[5-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]isoindole-1,3-dione |
| SMILES | O=C1NC(=S)S/C1=C/c1ccc(-c2ccc3c(c2)C(=O)NC3=O)o1 |
| InChI | InChI=1S/C16H8N2O4S2/c19-13-9-3-1-7(5-10(9)14(20)17-13)11-4-2-8(22-11)6-12-15(21)18-16(23)24-12/h1-6H,(H,17,19,20)(H,18,21,23)/b12-6+ |
| InChIKey | GNTYHOAPSXKMBV-WUXMJOGZSA-N |
| XLogP | 2.32 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|