C22H11NO4S2 — CID 21214291
2-[5-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]anthracene-9,10-dione (PubChem CID 21214291) has the molecular formula C22H11NO4S2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[5-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]anthracene-9,10-dione.
| Compound Name | 2-[5-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 21214291 |
| Molecular Formula | C22H11NO4S2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 2-[5-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]anthracene-9,10-dione |
| SMILES | O=C1NC(=S)S/C1=C\c1ccc(-c2ccc3c(c2)C(=O)c2ccccc2C3=O)o1 |
| InChI | InChI=1S/C22H11NO4S2/c24-19-13-3-1-2-4-14(13)20(25)16-9-11(5-7-15(16)19)17-8-6-12(27-17)10-18-21(26)23-22(28)29-18/h1-10H,(H,23,26,28)/b18-10- |
| InChIKey | VRVBZXJVFYVDLL-ZDLGFXPLSA-N |
| XLogP | 4.21 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|