C14H9NO5S3 — CID 18530533
4-[5-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzenesulfonic acid (PubChem CID 18530533) has the molecular formula C14H9NO5S3 and a molecular weight of 367.43 g/mol. Its IUPAC name is 4-[5-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzenesulfonic acid.
| Compound Name | 4-[5-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 18530533 |
| Molecular Formula | C14H9NO5S3 |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 4-[5-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzenesulfonic acid |
| SMILES | O=C1NC(=S)S/C1=C/c1ccc(-c2ccc(S(=O)(=O)O)cc2)o1 |
| InChI | InChI=1S/C14H9NO5S3/c16-13-12(22-14(21)15-13)7-9-3-6-11(20-9)8-1-4-10(5-2-8)23(17,18)19/h1-7H,(H,15,16,21)(H,17,18,19)/b12-7+ |
| InChIKey | SGXBQFWXLITYHC-KPKJPENVSA-N |
| XLogP | 2.68 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|