C23H14BrN3O4 — CID 6530597
5-[5-[(E)-[1-(4-bromophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]isoindole-1,3-dione (PubChem CID 6530597) has the molecular formula C23H14BrN3O4 and a molecular weight of 476.29 g/mol. Its IUPAC name is 5-[5-[(E)-[1-(4-bromophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]isoindole-1,3-dione.
| Compound Name | 5-[5-[(E)-[1-(4-bromophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6530597 |
| Molecular Formula | C23H14BrN3O4 |
| Molecular Weight | 476.29 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | 5-[5-[(E)-[1-(4-bromophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]isoindole-1,3-dione |
| SMILES | CC1=NN(c2ccc(Br)cc2)C(=O)/C1=C/c1ccc(-c2ccc3c(c2)C(=O)NC3=O)o1 |
| InChI | InChI=1S/C23H14BrN3O4/c1-12-18(23(30)27(26-12)15-5-3-14(24)4-6-15)11-16-7-9-20(31-16)13-2-8-17-19(10-13)22(29)25-21(17)28/h2-11H,1H3,(H,25,28,29)/b18-11+ |
| InChIKey | HHAJCZXADJCZIE-WOJGMQOQSA-N |
| XLogP | 4.40 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|