C19H17BrN2O — CID 124560954
N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline (PubChem CID 124560954) has the molecular formula C19H17BrN2O and a molecular weight of 369.26 g/mol. Its IUPAC name is N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline.
| Compound Name | N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 124560954 |
| Molecular Formula | C19H17BrN2O |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline |
| SMILES | Cc1ccc(N/N=C\c2ccc(-c3ccc(Br)cc3)o2)c(C)c1 |
| InChI | InChI=1S/C19H17BrN2O/c1-13-3-9-18(14(2)11-13)22-21-12-17-8-10-19(23-17)15-4-6-16(20)7-5-15/h3-12,22H,1-2H3/b21-12- |
| InChIKey | SEMPUCRIJUHTGS-MTJSOVHGSA-N |
| XLogP | 5.77 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|