About N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline
N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline (PubChem CID 124560954) has the molecular formula C19H17BrN2O
and a molecular weight of 369.26 g/mol. Its IUPAC name is N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline.
Molecular Properties
| Compound Name | N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline |
| PubChem CID | 124560954 |
| Molecular Formula | C19H17BrN2O |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline |
| SMILES | Cc1ccc(N/N=C\c2ccc(-c3ccc(Br)cc3)o2)c(C)c1 |
| InChI | InChI=1S/C19H17BrN2O/c1-13-3-9-18(14(2)11-13)22-21-12-17-8-10-19(23-17)15-4-6-16(20)7-5-15/h3-12,22H,1-2H3/b21-12- |
| InChIKey | SEMPUCRIJUHTGS-MTJSOVHGSA-N |
| XLogP | 5.77 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline?
The IUPAC name of N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline (CID 124560954) is N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline.
What is the SMILES notation for N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline?
The canonical SMILES for N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline is Cc1ccc(N/N=C\c2ccc(-c3ccc(Br)cc3)o2)c(C)c1.
What is the InChIKey of N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline?
The InChIKey is SEMPUCRIJUHTGS-MTJSOVHGSA-N. The full InChI is InChI=1S/C19H17BrN2O/c1-13-3-9-18(14(2)11-13)22-21-12-17-8-10-19(23-17)15-4-6-16(20)7-5-15/h3-12,22H,1-2H3/b21-12-.
What are the key properties of N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline?
N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline has a molecular weight of 369.26 g/mol, XLogP of 5.77, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2,4-dimethylaniline is sourced from PubChem (CID 124560954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).