C22H14BrF3N4O — CID 45128965
N-[(E)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4-phenyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 45128965) has the molecular formula C22H14BrF3N4O and a molecular weight of 487.28 g/mol. Its IUPAC name is N-[(E)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4-phenyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(E)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4-phenyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 45128965 |
| Molecular Formula | C22H14BrF3N4O |
| Molecular Weight | 487.28 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | N-[(E)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4-phenyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)c1cc(-c2ccccc2)nc(N/N=C/c2ccc(-c3ccc(Br)cc3)o2)n1 |
| InChI | InChI=1S/C22H14BrF3N4O/c23-16-8-6-15(7-9-16)19-11-10-17(31-19)13-27-30-21-28-18(14-4-2-1-3-5-14)12-20(29-21)22(24,25)26/h1-13H,(H,28,29,30)/b27-13+ |
| InChIKey | LMZRQKQYQPBKEG-UVHMKAGCSA-N |
| XLogP | 6.63 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.28 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|