C17H12F4N4S — CID 124854341
N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 124854341) has the molecular formula C17H12F4N4S and a molecular weight of 380.37 g/mol. Its IUPAC name is N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 124854341 |
| Molecular Formula | C17H12F4N4S |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nc(N/N=C\c3ccc(F)s3)n2)cc1 |
| InChI | InChI=1S/C17H12F4N4S/c1-10-2-4-11(5-3-10)13-8-14(17(19,20)21)24-16(23-13)25-22-9-12-6-7-15(18)26-12/h2-9H,1H3,(H,23,24,25)/b22-9- |
| InChIKey | XBGBYVCBUOBEQT-AFPJDJCSSA-N |
| XLogP | 5.12 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|