About N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine
N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 44824552) has the molecular formula C18H18F3N5
and a molecular weight of 361.37 g/mol. Its IUPAC name is N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine |
| PubChem CID | 44824552 |
| Molecular Formula | C18H18F3N5 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nc(NCc3cc(C)nn3C)n2)cc1 |
| InChI | InChI=1S/C18H18F3N5/c1-11-4-6-13(7-5-11)15-9-16(18(19,20)21)24-17(23-15)22-10-14-8-12(2)25-26(14)3/h4-9H,10H2,1-3H3,(H,22,23,24) |
| InChIKey | KKYVWTHRDSTWMD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine?
The IUPAC name of N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine (CID 44824552) is N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine.
What is the SMILES notation for N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine?
The canonical SMILES for N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine is Cc1ccc(-c2cc(C(F)(F)F)nc(NCc3cc(C)nn3C)n2)cc1.
What is the InChIKey of N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine?
The InChIKey is KKYVWTHRDSTWMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F3N5/c1-11-4-6-13(7-5-11)15-9-16(18(19,20)21)24-17(23-15)22-10-14-8-12(2)25-26(14)3/h4-9H,10H2,1-3H3,(H,22,23,24).
What are the key properties of N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine?
N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine has a molecular weight of 361.37 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,5-dimethylpyrazol-3-yl)methyl]-4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-amine is sourced from PubChem (CID 44824552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).