C17H12F4N4OS — CID 124856131
N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-4-(2-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 124856131) has the molecular formula C17H12F4N4OS and a molecular weight of 396.37 g/mol. Its IUPAC name is N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-4-(2-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-4-(2-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 124856131 |
| Molecular Formula | C17H12F4N4OS |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-4-(2-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | COc1ccccc1-c1cc(C(F)(F)F)nc(N/N=C\c2ccc(F)s2)n1 |
| InChI | InChI=1S/C17H12F4N4OS/c1-26-13-5-3-2-4-11(13)12-8-14(17(19,20)21)24-16(23-12)25-22-9-10-6-7-15(18)27-10/h2-9H,1H3,(H,23,24,25)/b22-9- |
| InChIKey | ZWQQACHKKTZDKF-AFPJDJCSSA-N |
| XLogP | 4.82 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|