C17H14F4N6 — CID 119056177
N-[(E)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-4-phenyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 119056177) has the molecular formula C17H14F4N6 and a molecular weight of 378.33 g/mol. Its IUPAC name is N-[(E)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-4-phenyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(E)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-4-phenyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 119056177 |
| Molecular Formula | C17H14F4N6 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[(E)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-4-phenyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCn1ncc(/C=N/Nc2nc(-c3ccccc3)cc(C(F)(F)F)n2)c1F |
| InChI | InChI=1S/C17H14F4N6/c1-2-27-15(18)12(10-23-27)9-22-26-16-24-13(11-6-4-3-5-7-11)8-14(25-16)17(19,20)21/h3-10H,2H2,1H3,(H,24,25,26)/b22-9+ |
| InChIKey | IDFYOQIJGYBIPW-LSFURLLWSA-N |
| XLogP | 3.96 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|