C17H18F4N8 — CID 124848720
4-(1-ethyl-5-methylpyrazol-4-yl)-N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 124848720) has the molecular formula C17H18F4N8 and a molecular weight of 410.38 g/mol. Its IUPAC name is 4-(1-ethyl-5-methylpyrazol-4-yl)-N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(1-ethyl-5-methylpyrazol-4-yl)-N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 124848720 |
| Molecular Formula | C17H18F4N8 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-(1-ethyl-5-methylpyrazol-4-yl)-N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCn1ncc(-c2cc(C(F)(F)F)nc(N/N=C\c3c(C)nn(C)c3F)n2)c1C |
| InChI | InChI=1S/C17H18F4N8/c1-5-29-10(3)12(8-23-29)13-6-14(17(19,20)21)25-16(24-13)26-22-7-11-9(2)27-28(4)15(11)18/h6-8H,5H2,1-4H3,(H,24,25,26)/b22-7- |
| InChIKey | NHJPDZOTGARFHV-HOEBFWFUSA-N |
| XLogP | 3.31 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|