C14H14F4N6 — CID 124849340
4-cyclopropyl-N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 124849340) has the molecular formula C14H14F4N6 and a molecular weight of 342.30 g/mol. Its IUPAC name is 4-cyclopropyl-N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-cyclopropyl-N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 124849340 |
| Molecular Formula | C14H14F4N6 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-cyclopropyl-N-[(Z)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1nn(C)c(F)c1/C=N\Nc1nc(C2CC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H14F4N6/c1-7-9(12(15)24(2)23-7)6-19-22-13-20-10(8-3-4-8)5-11(21-13)14(16,17)18/h5-6,8H,3-4H2,1-2H3,(H,20,21,22)/b19-6- |
| InChIKey | OMRVQPCFVHYPGY-SWNXQHNESA-N |
| XLogP | 3.00 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|