C17H19F3N8 — CID 171131222
4-(difluoromethyl)-6-(1-ethyl-5-methylpyrazol-4-yl)-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]pyrimidin-2-amine (PubChem CID 171131222) has the molecular formula C17H19F3N8 and a molecular weight of 392.39 g/mol. Its IUPAC name is 4-(difluoromethyl)-6-(1-ethyl-5-methylpyrazol-4-yl)-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]pyrimidin-2-amine.
| Compound Name | 4-(difluoromethyl)-6-(1-ethyl-5-methylpyrazol-4-yl)-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 171131222 |
| Molecular Formula | C17H19F3N8 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-(difluoromethyl)-6-(1-ethyl-5-methylpyrazol-4-yl)-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]pyrimidin-2-amine |
| SMILES | CCn1ncc(-c2cc(C(F)F)nc(NN=Cc3c(C)nn(C)c3F)n2)c1C |
| InChI | InChI=1S/C17H19F3N8/c1-5-28-10(3)12(8-22-28)13-6-14(15(18)19)24-17(23-13)25-21-7-11-9(2)26-27(4)16(11)20/h6-8,15H,5H2,1-4H3,(H,23,24,25) |
| InChIKey | BVLIWMHQMHVVAV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|