C15H21F2N5O — CID 44821712
4-(difluoromethyl)-6-(1-ethyl-5-methylpyrazol-4-yl)-N-(3-methoxypropyl)pyrimidin-2-amine (PubChem CID 44821712) has the molecular formula C15H21F2N5O and a molecular weight of 325.36 g/mol. Its IUPAC name is 4-(difluoromethyl)-6-(1-ethyl-5-methylpyrazol-4-yl)-N-(3-methoxypropyl)pyrimidin-2-amine.
| Compound Name | 4-(difluoromethyl)-6-(1-ethyl-5-methylpyrazol-4-yl)-N-(3-methoxypropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 44821712 |
| Molecular Formula | C15H21F2N5O |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 4-(difluoromethyl)-6-(1-ethyl-5-methylpyrazol-4-yl)-N-(3-methoxypropyl)pyrimidin-2-amine |
| SMILES | CCn1ncc(-c2cc(C(F)F)nc(NCCCOC)n2)c1C |
| InChI | InChI=1S/C15H21F2N5O/c1-4-22-10(2)11(9-19-22)12-8-13(14(16)17)21-15(20-12)18-6-5-7-23-3/h8-9,14H,4-7H2,1-3H3,(H,18,20,21) |
| InChIKey | HAUZYLITMXYLBG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|