C15H13F3N6O — CID 119056166
4-(difluoromethyl)-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-6-(furan-2-yl)pyrimidin-2-amine (PubChem CID 119056166) has the molecular formula C15H13F3N6O and a molecular weight of 350.30 g/mol. Its IUPAC name is 4-(difluoromethyl)-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-6-(furan-2-yl)pyrimidin-2-amine.
| Compound Name | 4-(difluoromethyl)-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-6-(furan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 119056166 |
| Molecular Formula | C15H13F3N6O |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-(difluoromethyl)-N-[(E)-(5-fluoro-1,3-dimethylpyrazol-4-yl)methylideneamino]-6-(furan-2-yl)pyrimidin-2-amine |
| SMILES | Cc1nn(C)c(F)c1/C=N/Nc1nc(-c2ccco2)cc(C(F)F)n1 |
| InChI | InChI=1S/C15H13F3N6O/c1-8-9(14(18)24(2)23-8)7-19-22-15-20-10(12-4-3-5-25-12)6-11(21-15)13(16)17/h3-7,13H,1-2H3,(H,20,21,22)/b19-7+ |
| InChIKey | XMSBSRXVGBSILX-FBCYGCLPSA-N |
| XLogP | 3.30 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|