C13H10F4N4S — CID 100612869
4-cyclopropyl-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 100612869) has the molecular formula C13H10F4N4S and a molecular weight of 330.31 g/mol. Its IUPAC name is 4-cyclopropyl-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-cyclopropyl-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 100612869 |
| Molecular Formula | C13H10F4N4S |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 4-cyclopropyl-N-[(Z)-(5-fluorothiophen-2-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Fc1ccc(/C=N\Nc2nc(C3CC3)cc(C(F)(F)F)n2)s1 |
| InChI | InChI=1S/C13H10F4N4S/c14-11-4-3-8(22-11)6-18-21-12-19-9(7-1-2-7)5-10(20-12)13(15,16)17/h3-7H,1-2H2,(H,19,20,21)/b18-6- |
| InChIKey | USKZCRUFGHHQRD-FXBPXSCXSA-N |
| XLogP | 4.02 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|