C17H16FN5OS — CID 119055774
6-cyclopropyl-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 119055774) has the molecular formula C17H16FN5OS and a molecular weight of 357.41 g/mol. Its IUPAC name is 6-cyclopropyl-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-cyclopropyl-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 119055774 |
| Molecular Formula | C17H16FN5OS |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 6-cyclopropyl-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1nn(C)c2nc(C3CC3)cc(C(=O)N/N=C/c3ccc(F)s3)c12 |
| InChI | InChI=1S/C17H16FN5OS/c1-9-15-12(17(24)21-19-8-11-5-6-14(18)25-11)7-13(10-3-4-10)20-16(15)23(2)22-9/h5-8,10H,3-4H2,1-2H3,(H,21,24)/b19-8+ |
| InChIKey | WRGAPMZDIYEDII-UFWORHAWSA-N |
| XLogP | 3.12 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|