C16H13FN4O2S — CID 119055750
6-cyclopropyl-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 119055750) has the molecular formula C16H13FN4O2S and a molecular weight of 344.37 g/mol. Its IUPAC name is 6-cyclopropyl-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-cyclopropyl-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 119055750 |
| Molecular Formula | C16H13FN4O2S |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 6-cyclopropyl-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1noc2nc(C3CC3)cc(C(=O)N/N=C/c3ccc(F)s3)c12 |
| InChI | InChI=1S/C16H13FN4O2S/c1-8-14-11(6-12(9-2-3-9)19-16(14)23-21-8)15(22)20-18-7-10-4-5-13(17)24-10/h4-7,9H,2-3H2,1H3,(H,20,22)/b18-7+ |
| InChIKey | YFRYLBIMMQNVBS-CNHKJKLMSA-N |
| XLogP | 3.37 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|