C16H8Cl2F4N4S — CID 119056128
4-(3,4-dichlorophenyl)-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 119056128) has the molecular formula C16H8Cl2F4N4S and a molecular weight of 435.23 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(3,4-dichlorophenyl)-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 119056128 |
| Molecular Formula | C16H8Cl2F4N4S |
| Molecular Weight | 435.23 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-[(E)-(5-fluorothiophen-2-yl)methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Fc1ccc(/C=N/Nc2nc(-c3ccc(Cl)c(Cl)c3)cc(C(F)(F)F)n2)s1 |
| InChI | InChI=1S/C16H8Cl2F4N4S/c17-10-3-1-8(5-11(10)18)12-6-13(16(20,21)22)25-15(24-12)26-23-7-9-2-4-14(19)27-9/h1-7H,(H,24,25,26)/b23-7+ |
| InChIKey | NKWHHQNUUVFEIA-HCGXMYGOSA-N |
| XLogP | 6.12 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.23 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|