C16H16F4N8 — CID 171131242
N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-4-(1-ethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 171131242) has the molecular formula C16H16F4N8 and a molecular weight of 396.35 g/mol. Its IUPAC name is N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-4-(1-ethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-4-(1-ethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 171131242 |
| Molecular Formula | C16H16F4N8 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-4-(1-ethylpyrazol-4-yl)-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCn1cc(-c2cc(C(F)(F)F)nc(NN=Cc3cnn(CC)c3F)n2)cn1 |
| InChI | InChI=1S/C16H16F4N8/c1-3-27-9-11(8-22-27)12-5-13(16(18,19)20)25-15(24-12)26-21-6-10-7-23-28(4-2)14(10)17/h5-9H,3-4H2,1-2H3,(H,24,25,26) |
| InChIKey | IGQZNIYBWKAQRN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|