C11H12F3N5 — CID 106769306
6-(1-ethylpyrazol-4-yl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106769306) has the molecular formula C11H12F3N5 and a molecular weight of 271.25 g/mol. Its IUPAC name is 6-(1-ethylpyrazol-4-yl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-(1-ethylpyrazol-4-yl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106769306 |
| Molecular Formula | C11H12F3N5 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 6-(1-ethylpyrazol-4-yl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCn1cc(-c2cc(NC)nc(C(F)(F)F)n2)cn1 |
| InChI | InChI=1S/C11H12F3N5/c1-3-19-6-7(5-16-19)8-4-9(15-2)18-10(17-8)11(12,13)14/h4-6H,3H2,1-2H3,(H,15,17,18) |
| InChIKey | VYROWVBSCAQMHE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |