C10H13N5 — CID 103570484
2-(1-ethylpyrazol-4-yl)-N-methylpyrimidin-4-amine (PubChem CID 103570484) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-4-yl)-N-methylpyrimidin-4-amine.
| Compound Name | 2-(1-ethylpyrazol-4-yl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 103570484 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 2-(1-ethylpyrazol-4-yl)-N-methylpyrimidin-4-amine |
| SMILES | CCn1cc(-c2nccc(NC)n2)cn1 |
| InChI | InChI=1S/C10H13N5/c1-3-15-7-8(6-13-15)10-12-5-4-9(11-2)14-10/h4-7H,3H2,1-2H3,(H,11,12,14) |
| InChIKey | IXOXXNQJMRIXDY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |