C9H11N5O2S — CID 167426029
2-[1-(methylsulfonylmethyl)pyrazol-4-yl]pyrimidin-4-amine (PubChem CID 167426029) has the molecular formula C9H11N5O2S and a molecular weight of 253.29 g/mol. Its IUPAC name is 2-[1-(methylsulfonylmethyl)pyrazol-4-yl]pyrimidin-4-amine.
| Compound Name | 2-[1-(methylsulfonylmethyl)pyrazol-4-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167426029 |
| Molecular Formula | C9H11N5O2S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-[1-(methylsulfonylmethyl)pyrazol-4-yl]pyrimidin-4-amine |
| SMILES | CS(=O)(=O)Cn1cc(-c2nccc(N)n2)cn1 |
| InChI | InChI=1S/C9H11N5O2S/c1-17(15,16)6-14-5-7(4-12-14)9-11-3-2-8(10)13-9/h2-5H,6H2,1H3,(H2,10,11,13) |
| InChIKey | LZQSJCVBFLQGQR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |