C10H13N3O3S — CID 122244856
N-[2-[4-(furan-3-yl)pyrazol-1-yl]ethyl]methanesulfonamide (PubChem CID 122244856) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is N-[2-[4-(furan-3-yl)pyrazol-1-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[4-(furan-3-yl)pyrazol-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 122244856 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N-[2-[4-(furan-3-yl)pyrazol-1-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCn1cc(-c2ccoc2)cn1 |
| InChI | InChI=1S/C10H13N3O3S/c1-17(14,15)12-3-4-13-7-10(6-11-13)9-2-5-16-8-9/h2,5-8,12H,3-4H2,1H3 |
| InChIKey | XNODQRNHTGDXHA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |