C20H19FN4O4S2 — CID 118060438
N-[2-[4-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]pyrazol-1-yl]ethyl]methanesulfonamide (PubChem CID 118060438) has the molecular formula C20H19FN4O4S2 and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[2-[4-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]pyrazol-1-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[4-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]pyrazol-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 118060438 |
| Molecular Formula | C20H19FN4O4S2 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[2-[4-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]pyrazol-1-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCn1cc(-c2cn(S(=O)(=O)c3ccccc3)c3cc(F)ccc23)cn1 |
| InChI | InChI=1S/C20H19FN4O4S2/c1-30(26,27)23-9-10-24-13-15(12-22-24)19-14-25(20-11-16(21)7-8-18(19)20)31(28,29)17-5-3-2-4-6-17/h2-8,11-14,23H,9-10H2,1H3 |
| InChIKey | GVGFHZYSYRLCLL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |