C17H15F2N3O2S — CID 119102967
2,6-difluoro-N-[2-(4-phenylpyrazol-1-yl)ethyl]benzenesulfonamide (PubChem CID 119102967) has the molecular formula C17H15F2N3O2S and a molecular weight of 363.39 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-(4-phenylpyrazol-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,6-difluoro-N-[2-(4-phenylpyrazol-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 119102967 |
| Molecular Formula | C17H15F2N3O2S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2,6-difluoro-N-[2-(4-phenylpyrazol-1-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCn1cc(-c2ccccc2)cn1)c1c(F)cccc1F |
| InChI | InChI=1S/C17H15F2N3O2S/c18-15-7-4-8-16(19)17(15)25(23,24)21-9-10-22-12-14(11-20-22)13-5-2-1-3-6-13/h1-8,11-12,21H,9-10H2 |
| InChIKey | BERRIBMOGSDOBL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |