C27H31FN4O4S2 — CID 118064883
1-(benzenesulfonyl)-6-fluoro-3-[1-[1-(4-methylsulfonylbutyl)piperidin-4-yl]pyrazol-4-yl]indole (PubChem CID 118064883) has the molecular formula C27H31FN4O4S2 and a molecular weight of 558.70 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-fluoro-3-[1-[1-(4-methylsulfonylbutyl)piperidin-4-yl]pyrazol-4-yl]indole.
| Compound Name | 1-(benzenesulfonyl)-6-fluoro-3-[1-[1-(4-methylsulfonylbutyl)piperidin-4-yl]pyrazol-4-yl]indole |
|---|---|
| PubChem CID | 118064883 |
| Molecular Formula | C27H31FN4O4S2 |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 1-(benzenesulfonyl)-6-fluoro-3-[1-[1-(4-methylsulfonylbutyl)piperidin-4-yl]pyrazol-4-yl]indole |
| SMILES | CS(=O)(=O)CCCCN1CCC(n2cc(-c3cn(S(=O)(=O)c4ccccc4)c4cc(F)ccc34)cn2)CC1 |
| InChI | InChI=1S/C27H31FN4O4S2/c1-37(33,34)16-6-5-13-30-14-11-23(12-15-30)31-19-21(18-29-31)26-20-32(27-17-22(28)9-10-25(26)27)38(35,36)24-7-3-2-4-8-24/h2-4,7-10,17-20,23H,5-6,11-16H2,1H3 |
| InChIKey | UJQNHNZTMJDXKH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|