C21H18FN5O3S — CID 118060632
3-[4-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]pyrazol-1-yl]azetidine-1-carboxamide (PubChem CID 118060632) has the molecular formula C21H18FN5O3S and a molecular weight of 439.47 g/mol. Its IUPAC name is 3-[4-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]pyrazol-1-yl]azetidine-1-carboxamide.
| Compound Name | 3-[4-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]pyrazol-1-yl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 118060632 |
| Molecular Formula | C21H18FN5O3S |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 3-[4-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]pyrazol-1-yl]azetidine-1-carboxamide |
| SMILES | NC(=O)N1CC(n2cc(-c3cn(S(=O)(=O)c4ccccc4)c4cc(F)ccc34)cn2)C1 |
| InChI | InChI=1S/C21H18FN5O3S/c22-15-6-7-18-19(14-9-24-26(10-14)16-11-25(12-16)21(23)28)13-27(20(18)8-15)31(29,30)17-4-2-1-3-5-17/h1-10,13,16H,11-12H2,(H2,23,28) |
| InChIKey | BIKSAOYRLAUMKU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |