C12H12F4N6O — CID 124851664
N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 124851664) has the molecular formula C12H12F4N6O and a molecular weight of 332.26 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 124851664 |
| Molecular Formula | C12H12F4N6O |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CCn1ncc(/C=N\NC(=O)c2cc(C(F)(F)F)nn2C)c1F |
| InChI | InChI=1S/C12H12F4N6O/c1-3-22-10(13)7(6-18-22)5-17-19-11(23)8-4-9(12(14,15)16)20-21(8)2/h4-6H,3H2,1-2H3,(H,19,23)/b17-5- |
| InChIKey | SRPOXGDIGGZFNI-ZWSORDCHSA-N |
| XLogP | 1.56 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|