C12H14BrFN6O — CID 124844030
2-(4-bromo-3-methylpyrazol-1-yl)-N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]acetamide (PubChem CID 124844030) has the molecular formula C12H14BrFN6O and a molecular weight of 357.19 g/mol. Its IUPAC name is 2-(4-bromo-3-methylpyrazol-1-yl)-N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-3-methylpyrazol-1-yl)-N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 124844030 |
| Molecular Formula | C12H14BrFN6O |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 2-(4-bromo-3-methylpyrazol-1-yl)-N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]acetamide |
| SMILES | CCn1ncc(/C=N\NC(=O)Cn2cc(Br)c(C)n2)c1F |
| InChI | InChI=1S/C12H14BrFN6O/c1-3-20-12(14)9(5-16-20)4-15-17-11(21)7-19-6-10(13)8(2)18-19/h4-6H,3,7H2,1-2H3,(H,17,21)/b15-4- |
| InChIKey | FNFFPGOSEBWTKB-TVPGTPATSA-N |
| XLogP | 1.46 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|