C13H16FN7O4 — CID 171131091
N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide (PubChem CID 171131091) has the molecular formula C13H16FN7O4 and a molecular weight of 353.31 g/mol. Its IUPAC name is N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 171131091 |
| Molecular Formula | C13H16FN7O4 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
| SMILES | CCn1ncc(C=NNC(=O)C(C)n2cc([N+](=O)[O-])c(OC)n2)c1F |
| InChI | InChI=1S/C13H16FN7O4/c1-4-19-11(14)9(6-16-19)5-15-17-12(22)8(2)20-7-10(21(23)24)13(18-20)25-3/h5-8H,4H2,1-3H3,(H,17,22) |
| InChIKey | AMWSIWJXIOVGTE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|