C21H19Cl2N5O5 — CID 28839299
(2S)-N-[(Z)-[2-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide (PubChem CID 28839299) has the molecular formula C21H19Cl2N5O5 and a molecular weight of 492.32 g/mol. Its IUPAC name is (2S)-N-[(Z)-[2-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide.
| Compound Name | (2S)-N-[(Z)-[2-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 28839299 |
| Molecular Formula | C21H19Cl2N5O5 |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | (2S)-N-[(Z)-[2-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
| SMILES | COc1nn([C@@H](C)C(=O)N/N=C\c2ccccc2OCc2c(Cl)cccc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H19Cl2N5O5/c1-13(27-11-18(28(30)31)21(26-27)32-2)20(29)25-24-10-14-6-3-4-9-19(14)33-12-15-16(22)7-5-8-17(15)23/h3-11,13H,12H2,1-2H3,(H,25,29)/b24-10-/t13-/m0/s1 |
| InChIKey | JLRGSVBUYHSVOM-TYSVLMOXSA-N |
| XLogP | 4.40 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|