C14H13Cl2N5O4 — CID 4113351
N-[(3,4-dichlorophenyl)methylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide (PubChem CID 4113351) has the molecular formula C14H13Cl2N5O4 and a molecular weight of 386.20 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[(3,4-dichlorophenyl)methylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 4113351 |
| Molecular Formula | C14H13Cl2N5O4 |
| Molecular Weight | 386.20 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
| SMILES | COc1nn(C(C)C(=O)NN=Cc2ccc(Cl)c(Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13Cl2N5O4/c1-8(20-7-12(21(23)24)14(19-20)25-2)13(22)18-17-6-9-3-4-10(15)11(16)5-9/h3-8H,1-2H3,(H,18,22) |
| InChIKey | WKVAMCXOUMATMX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|