C13H12BrFN4O — CID 171131075
2-bromo-N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]benzamide (PubChem CID 171131075) has the molecular formula C13H12BrFN4O and a molecular weight of 339.17 g/mol. Its IUPAC name is 2-bromo-N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 171131075 |
| Molecular Formula | C13H12BrFN4O |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-bromo-N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]benzamide |
| SMILES | CCn1ncc(C=NNC(=O)c2ccccc2Br)c1F |
| InChI | InChI=1S/C13H12BrFN4O/c1-2-19-12(15)9(8-17-19)7-16-18-13(20)10-5-3-4-6-11(10)14/h3-8H,2H2,1H3,(H,18,20) |
| InChIKey | FFOTXKMWBCGRGJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|