C16H15FN6O2 — CID 171131079
N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-3-(4-methylphenyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 171131079) has the molecular formula C16H15FN6O2 and a molecular weight of 342.33 g/mol. Its IUPAC name is N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-3-(4-methylphenyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-3-(4-methylphenyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 171131079 |
| Molecular Formula | C16H15FN6O2 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-3-(4-methylphenyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCn1ncc(C=NNC(=O)c2nc(-c3ccc(C)cc3)no2)c1F |
| InChI | InChI=1S/C16H15FN6O2/c1-3-23-13(17)12(9-19-23)8-18-21-15(24)16-20-14(22-25-16)11-6-4-10(2)5-7-11/h4-9H,3H2,1-2H3,(H,21,24) |
| InChIKey | DKDCVTNEQDKSBH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|