C16H22F3N5 — CID 44822001
4-(1,5-dimethylpyrazol-4-yl)-N-hexyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 44822001) has the molecular formula C16H22F3N5 and a molecular weight of 341.38 g/mol. Its IUPAC name is 4-(1,5-dimethylpyrazol-4-yl)-N-hexyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(1,5-dimethylpyrazol-4-yl)-N-hexyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 44822001 |
| Molecular Formula | C16H22F3N5 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 4-(1,5-dimethylpyrazol-4-yl)-N-hexyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCCCCCNc1nc(-c2cnn(C)c2C)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H22F3N5/c1-4-5-6-7-8-20-15-22-13(9-14(23-15)16(17,18)19)12-10-21-24(3)11(12)2/h9-10H,4-8H2,1-3H3,(H,20,22,23) |
| InChIKey | FLFSGXAZICYVPJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|