C15H13BrFN5S — CID 124846021
4-(4-bromophenyl)-N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 124846021) has the molecular formula C15H13BrFN5S and a molecular weight of 394.27 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-bromophenyl)-N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 124846021 |
| Molecular Formula | C15H13BrFN5S |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 4-(4-bromophenyl)-N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | CCn1ncc(/C=N\Nc2nc(-c3ccc(Br)cc3)cs2)c1F |
| InChI | InChI=1S/C15H13BrFN5S/c1-2-22-14(17)11(8-19-22)7-18-21-15-20-13(9-23-15)10-3-5-12(16)6-4-10/h3-9H,2H2,1H3,(H,20,21)/b18-7- |
| InChIKey | IBFQUJJCDAPDBD-WSVATBPTSA-N |
| XLogP | 4.37 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|