C18H20BrN3OS — CID 5056842
1-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-3-cyclohexylthiourea (PubChem CID 5056842) has the molecular formula C18H20BrN3OS and a molecular weight of 406.35 g/mol. Its IUPAC name is 1-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-3-cyclohexylthiourea.
| Compound Name | 1-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 5056842 |
| Molecular Formula | C18H20BrN3OS |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 1-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-3-cyclohexylthiourea |
| SMILES | S=C(NN=Cc1ccc(-c2ccc(Br)cc2)o1)NC1CCCCC1 |
| InChI | InChI=1S/C18H20BrN3OS/c19-14-8-6-13(7-9-14)17-11-10-16(23-17)12-20-22-18(24)21-15-4-2-1-3-5-15/h6-12,15H,1-5H2,(H2,21,22,24) |
| InChIKey | HQQCEHJAZJROFF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|