C21H16N4O3S2 — CID 4650922
3-acetamido-N-[[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]methylideneamino]benzamide (PubChem CID 4650922) has the molecular formula C21H16N4O3S2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 3-acetamido-N-[[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]methylideneamino]benzamide.
| Compound Name | 3-acetamido-N-[[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 4650922 |
| Molecular Formula | C21H16N4O3S2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 3-acetamido-N-[[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]methylideneamino]benzamide |
| SMILES | CC(=O)Nc1cccc(C(=O)NN=Cc2ccc(Sc3nc4ccccc4s3)o2)c1 |
| InChI | InChI=1S/C21H16N4O3S2/c1-13(26)23-15-6-4-5-14(11-15)20(27)25-22-12-16-9-10-19(28-16)30-21-24-17-7-2-3-8-18(17)29-21/h2-12H,1H3,(H,23,26)(H,25,27) |
| InChIKey | KQLUZQSZBKOCHH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|