C16H13N3O2S2 — CID 176948583
3-methyl-N-[(E)-[5-(1,3-thiazol-2-ylsulfanyl)furan-2-yl]methylideneamino]benzamide (PubChem CID 176948583) has the molecular formula C16H13N3O2S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-methyl-N-[(E)-[5-(1,3-thiazol-2-ylsulfanyl)furan-2-yl]methylideneamino]benzamide.
| Compound Name | 3-methyl-N-[(E)-[5-(1,3-thiazol-2-ylsulfanyl)furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 176948583 |
| Molecular Formula | C16H13N3O2S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 3-methyl-N-[(E)-[5-(1,3-thiazol-2-ylsulfanyl)furan-2-yl]methylideneamino]benzamide |
| SMILES | Cc1cccc(C(=O)N/N=C/c2ccc(Sc3nccs3)o2)c1 |
| InChI | InChI=1S/C16H13N3O2S2/c1-11-3-2-4-12(9-11)15(20)19-18-10-13-5-6-14(21-13)23-16-17-7-8-22-16/h2-10H,1H3,(H,19,20)/b18-10+ |
| InChIKey | AMVGHRGKCPHIJK-VCHYOVAHSA-N |
| XLogP | 3.96 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|