C24H23N3O4S2 — CID 17047940
4-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[5-[(4-methoxyphenyl)methoxy]furan-2-yl]methylideneamino]butanamide (PubChem CID 17047940) has the molecular formula C24H23N3O4S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[5-[(4-methoxyphenyl)methoxy]furan-2-yl]methylideneamino]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[5-[(4-methoxyphenyl)methoxy]furan-2-yl]methylideneamino]butanamide |
|---|---|
| PubChem CID | 17047940 |
| Molecular Formula | C24H23N3O4S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[5-[(4-methoxyphenyl)methoxy]furan-2-yl]methylideneamino]butanamide |
| SMILES | COc1ccc(COc2ccc(/C=N/NC(=O)CCCSc3nc4ccccc4s3)o2)cc1 |
| InChI | InChI=1S/C24H23N3O4S2/c1-29-18-10-8-17(9-11-18)16-30-23-13-12-19(31-23)15-25-27-22(28)7-4-14-32-24-26-20-5-2-3-6-21(20)33-24/h2-3,5-6,8-13,15H,4,7,14,16H2,1H3,(H,27,28)/b25-15+ |
| InChIKey | YOOOMTBFYUDRCI-MFKUBSTISA-N |
| XLogP | 5.50 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|