C23H23N5O3S2 — CID 17047897
4-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[4-methoxy-3-(pyrazol-1-ylmethoxy)phenyl]methylideneamino]butanamide (PubChem CID 17047897) has the molecular formula C23H23N5O3S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[4-methoxy-3-(pyrazol-1-ylmethoxy)phenyl]methylideneamino]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[4-methoxy-3-(pyrazol-1-ylmethoxy)phenyl]methylideneamino]butanamide |
|---|---|
| PubChem CID | 17047897 |
| Molecular Formula | C23H23N5O3S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[4-methoxy-3-(pyrazol-1-ylmethoxy)phenyl]methylideneamino]butanamide |
| SMILES | COc1ccc(/C=N/NC(=O)CCCSc2nc3ccccc3s2)cc1OCn1cccn1 |
| InChI | InChI=1S/C23H23N5O3S2/c1-30-19-10-9-17(14-20(19)31-16-28-12-5-11-25-28)15-24-27-22(29)8-4-13-32-23-26-18-6-2-3-7-21(18)33-23/h2-3,5-7,9-12,14-15H,4,8,13,16H2,1H3,(H,27,29)/b24-15+ |
| InChIKey | BTWAWVRLDGUITA-BUVRLJJBSA-N |
| XLogP | 4.56 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|