C27H24N8O3S — CID 17047919
N-[(E)-[4-methoxy-3-(pyrazol-1-ylmethoxy)phenyl]methylideneamino]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 17047919) has the molecular formula C27H24N8O3S and a molecular weight of 540.61 g/mol. Its IUPAC name is N-[(E)-[4-methoxy-3-(pyrazol-1-ylmethoxy)phenyl]methylideneamino]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-[4-methoxy-3-(pyrazol-1-ylmethoxy)phenyl]methylideneamino]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 17047919 |
| Molecular Formula | C27H24N8O3S |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | N-[(E)-[4-methoxy-3-(pyrazol-1-ylmethoxy)phenyl]methylideneamino]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | COc1ccc(/C=N/NC(=O)CSc2nnc(-c3cccnc3)n2-c2ccccc2)cc1OCn1cccn1 |
| InChI | InChI=1S/C27H24N8O3S/c1-37-23-11-10-20(15-24(23)38-19-34-14-6-13-30-34)16-29-31-25(36)18-39-27-33-32-26(21-7-5-12-28-17-21)35(27)22-8-3-2-4-9-22/h2-17H,18-19H2,1H3,(H,31,36)/b29-16+ |
| InChIKey | FCOZNTSSWARPPX-MUFRIFMGSA-N |
| XLogP | 3.81 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|