C27H28N6O5S — CID 6118819
2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 6118819) has the molecular formula C27H28N6O5S and a molecular weight of 548.63 g/mol. Its IUPAC name is 2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6118819 |
| Molecular Formula | C27H28N6O5S |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)N/N=C\c3c(OC)cc(OC)cc3OC)nnc2-c2cccnc2)cc1 |
| InChI | InChI=1S/C27H28N6O5S/c1-5-38-20-10-8-19(9-11-20)33-26(18-7-6-12-28-15-18)31-32-27(33)39-17-25(34)30-29-16-22-23(36-3)13-21(35-2)14-24(22)37-4/h6-16H,5,17H2,1-4H3,(H,30,34)/b29-16- |
| InChIKey | QORNWWRUDPMYHI-MWLSYYOVSA-N |
| XLogP | 4.00 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|