C24H20Cl2N6O2S — CID 6130269
N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 6130269) has the molecular formula C24H20Cl2N6O2S and a molecular weight of 527.44 g/mol. Its IUPAC name is N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6130269 |
| Molecular Formula | C24H20Cl2N6O2S |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)N/N=C\c3cccc(Cl)c3Cl)nnc2-c2cccnc2)cc1 |
| InChI | InChI=1S/C24H20Cl2N6O2S/c1-2-34-19-10-8-18(9-11-19)32-23(17-6-4-12-27-13-17)30-31-24(32)35-15-21(33)29-28-14-16-5-3-7-20(25)22(16)26/h3-14H,2,15H2,1H3,(H,29,33)/b28-14- |
| InChIKey | DYTOGGWYIACFLM-MUXKCCDJSA-N |
| XLogP | 5.28 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|